C30H53N — CID 134550357
(9E,11E)-12-(3-ethyl-3-methylcyclohexyl)-N-[(3Z)-hexa-1,3-dien-2-yl]-2,5,10-trimethyldodeca-9,11-dien-4-amine (PubChem CID 134550357) has the molecular formula C30H53N and a molecular weight of 427.76 g/mol. Its IUPAC name is (9E,11E)-12-(3-ethyl-3-methylcyclohexyl)-N-[(3Z)-hexa-1,3-dien-2-yl]-2,5,10-trimethyldodeca-9,11-dien-4-amine.
| Compound Name | (9E,11E)-12-(3-ethyl-3-methylcyclohexyl)-N-[(3Z)-hexa-1,3-dien-2-yl]-2,5,10-trimethyldodeca-9,11-dien-4-amine |
|---|---|
| PubChem CID | 134550357 |
| Molecular Formula | C30H53N |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.42 |
| IUPAC Name | (9E,11E)-12-(3-ethyl-3-methylcyclohexyl)-N-[(3Z)-hexa-1,3-dien-2-yl]-2,5,10-trimethyldodeca-9,11-dien-4-amine |
| SMILES | C=C(/C=C\CC)NC(CC(C)C)C(C)CCC/C=C(C)/C=C/C1CCCC(C)(CC)C1 |
| InChI | InChI=1S/C30H53N/c1-9-11-17-27(7)31-29(22-24(3)4)26(6)16-13-12-15-25(5)19-20-28-18-14-21-30(8,10-2)23-28/h11,15,17,19-20,24,26,28-29,31H,7,9-10,12-14,16,18,21-23H2,1-6,8H3/b17-11-,20-19+,25-15+ |
| InChIKey | RJPXMPKAPTXWMO-MGHIIAOPSA-N |
| XLogP | 9.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|