C17H27NO — CID 134550383
(2R,3R,5S,6S)-N-buta-1,3-dien-2-yl-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-amine (PubChem CID 134550383) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2R,3R,5S,6S)-N-buta-1,3-dien-2-yl-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-amine.
| Compound Name | (2R,3R,5S,6S)-N-buta-1,3-dien-2-yl-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-amine |
|---|---|
| PubChem CID | 134550383 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2R,3R,5S,6S)-N-buta-1,3-dien-2-yl-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-amine |
| SMILES | C=CC(=C)N[C@@H]1C[C@H](C)[C@H](C/C=C(\C)C=C)O[C@@H]1C |
| InChI | InChI=1S/C17H27NO/c1-7-12(3)9-10-17-13(4)11-16(15(6)19-17)18-14(5)8-2/h7-9,13,15-18H,1-2,5,10-11H2,3-4,6H3/b12-9+/t13-,15+,16+,17-/m0/s1 |
| InChIKey | KVAUQSRXXZTGCE-NGXACGOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|