About (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine
(4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine (PubChem CID 134550699) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine.
Molecular Properties
| Compound Name | (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine |
| PubChem CID | 134550699 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine |
| SMILES | C=C/C=C(\C)C1=NC=C/C(=C/C=C\CC=C)C1 |
| InChI | InChI=1S/C16H19N/c1-4-6-7-8-10-15-11-12-17-16(13-15)14(3)9-5-2/h4-5,7-12H,1-2,6,13H2,3H3/b8-7-,14-9+,15-10- |
| InChIKey | RNXFGKWVSKFIFI-HBGISZIWSA-N |
| XLogP | 4.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine?
The IUPAC name of (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine (CID 134550699) is (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine.
What is the SMILES notation for (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine?
The canonical SMILES for (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine is C=C/C=C(\C)C1=NC=C/C(=C/C=C\CC=C)C1.
What is the InChIKey of (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine?
The InChIKey is RNXFGKWVSKFIFI-HBGISZIWSA-N. The full InChI is InChI=1S/C16H19N/c1-4-6-7-8-10-15-11-12-17-16(13-15)14(3)9-5-2/h4-5,7-12H,1-2,6,13H2,3H3/b8-7-,14-9+,15-10-.
What are the key properties of (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine?
(4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine has a molecular weight of 225.33 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(2Z)-hexa-2,5-dienylidene]-2-[(2E)-penta-2,4-dien-2-yl]-3H-pyridine is sourced from PubChem (CID 134550699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).