About 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline
2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline (PubChem CID 134550731) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline |
| PubChem CID | 134550731 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline |
| SMILES | Cc1ccc(C2=NC3CC=CC=C3C=C2)cc1C |
| InChI | InChI=1S/C17H17N/c1-12-7-8-15(11-13(12)2)17-10-9-14-5-3-4-6-16(14)18-17/h3-5,7-11,16H,6H2,1-2H3 |
| InChIKey | ACFYLYQGCYTODL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline?
The IUPAC name of 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline (CID 134550731) is 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline.
What is the SMILES notation for 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline?
The canonical SMILES for 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline is Cc1ccc(C2=NC3CC=CC=C3C=C2)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline?
The InChIKey is ACFYLYQGCYTODL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-12-7-8-15(11-13(12)2)17-10-9-14-5-3-4-6-16(14)18-17/h3-5,7-11,16H,6H2,1-2H3.
What are the key properties of 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline?
2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline has a molecular weight of 235.33 g/mol, XLogP of 3.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)-8,8a-dihydroquinoline is sourced from PubChem (CID 134550731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).