C25H22FN5O2 — CID 134551004
N-[(8R)-4-amino-5-[4-(4-fluorophenoxy)phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide (PubChem CID 134551004) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[(8R)-4-amino-5-[4-(4-fluorophenoxy)phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide.
| Compound Name | N-[(8R)-4-amino-5-[4-(4-fluorophenoxy)phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide |
|---|---|
| PubChem CID | 134551004 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[(8R)-4-amino-5-[4-(4-fluorophenoxy)phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCc2c(-c3ccc(Oc4ccc(F)cc4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C25H22FN5O2/c1-2-21(32)30-17-7-12-20-22(23-24(27)28-14-29-25(23)31(20)13-17)15-3-8-18(9-4-15)33-19-10-5-16(26)6-11-19/h2-6,8-11,14,17H,1,7,12-13H2,(H,30,32)(H2,27,28,29)/t17-/m1/s1 |
| InChIKey | PKEAUVYBWZLGKK-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|