C26H22F3N7O2 — CID 134551006
4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 134551006) has the molecular formula C26H22F3N7O2 and a molecular weight of 521.50 g/mol. Its IUPAC name is 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 134551006 |
| Molecular Formula | C26H22F3N7O2 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | C=CC(=O)N[C@@H]1CCc2c(-c3ccc(C(=O)Nc4cc(C(F)(F)F)ccn4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C26H22F3N7O2/c1-2-20(37)34-17-7-8-18-21(22-23(30)32-13-33-24(22)36(18)12-17)14-3-5-15(6-4-14)25(38)35-19-11-16(9-10-31-19)26(27,28)29/h2-6,9-11,13,17H,1,7-8,12H2,(H,34,37)(H2,30,32,33)(H,31,35,38)/t17-/m1/s1 |
| InChIKey | NFKKJCDNOZAMMO-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|