C25H22FN7O2 — CID 134551022
4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-(5-fluoro-2-pyridinyl)benzamide (PubChem CID 134551022) has the molecular formula C25H22FN7O2 and a molecular weight of 471.50 g/mol. Its IUPAC name is 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-(5-fluoro-2-pyridinyl)benzamide.
| Compound Name | 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-(5-fluoro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 134551022 |
| Molecular Formula | C25H22FN7O2 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[(8R)-4-amino-8-(prop-2-enoylamino)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-5-yl]-N-(5-fluoro-2-pyridinyl)benzamide |
| SMILES | C=CC(=O)N[C@@H]1CCc2c(-c3ccc(C(=O)Nc4ccc(F)cn4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C25H22FN7O2/c1-2-20(34)31-17-8-9-18-21(22-23(27)29-13-30-24(22)33(18)12-17)14-3-5-15(6-4-14)25(35)32-19-10-7-16(26)11-28-19/h2-7,10-11,13,17H,1,8-9,12H2,(H,31,34)(H2,27,29,30)(H,28,32,35)/t17-/m1/s1 |
| InChIKey | DNFQAMXTOTYCBX-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|