C11H23N — CID 134551035
2,2,6,6-tetramethylheptan-3-imine (PubChem CID 134551035) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 2,2,6,6-tetramethylheptan-3-imine.
| Compound Name | 2,2,6,6-tetramethylheptan-3-imine |
|---|---|
| PubChem CID | 134551035 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2,2,6,6-tetramethylheptan-3-imine |
| SMILES | [H]/N=C(\CCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H23N/c1-10(2,3)8-7-9(12)11(4,5)6/h12H,7-8H2,1-6H3/b12-9+ |
| InChIKey | PYPWPJGRYOLDFI-FMIVXFBMSA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|