About 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine
2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine (PubChem CID 134551045) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine.
Molecular Properties
| Compound Name | 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine |
| PubChem CID | 134551045 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine |
| SMILES | CC(C)(C)CCC1=CC=CN=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H27N/c1-15(2,3)10-9-13-8-7-11-17-14(12-13)16(4,5)6/h7-8,11H,9-10,12H2,1-6H3 |
| InChIKey | MQQQTDKRBKBBPJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine?
The IUPAC name of 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine (CID 134551045) is 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine.
What is the SMILES notation for 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine?
The canonical SMILES for 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine is CC(C)(C)CCC1=CC=CN=C(C(C)(C)C)C1.
What is the InChIKey of 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine?
The InChIKey is MQQQTDKRBKBBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-15(2,3)10-9-13-8-7-11-17-14(12-13)16(4,5)6/h7-8,11H,9-10,12H2,1-6H3.
What are the key properties of 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine?
2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine has a molecular weight of 233.40 g/mol, XLogP of 5.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(3,3-dimethylbutyl)-3H-azepine is sourced from PubChem (CID 134551045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).