C26H21N5O2 — CID 134551049
N-[(7R)-4-amino-6-methylidene-5-(4-phenoxyphenyl)-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl]but-2-ynamide (PubChem CID 134551049) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[(7R)-4-amino-6-methylidene-5-(4-phenoxyphenyl)-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl]but-2-ynamide.
| Compound Name | N-[(7R)-4-amino-6-methylidene-5-(4-phenoxyphenyl)-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl]but-2-ynamide |
|---|---|
| PubChem CID | 134551049 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(7R)-4-amino-6-methylidene-5-(4-phenoxyphenyl)-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl]but-2-ynamide |
| SMILES | C=C1c2c(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc3n2C[C@@H]1NC(=O)C#CC |
| InChI | InChI=1S/C26H21N5O2/c1-3-7-21(32)30-20-14-31-24(16(20)2)22(23-25(27)28-15-29-26(23)31)17-10-12-19(13-11-17)33-18-8-5-4-6-9-18/h4-6,8-13,15,20H,2,14H2,1H3,(H,30,32)(H2,27,28,29)/t20-/m0/s1 |
| InChIKey | IKIIYQAGWPMYCC-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|