C28H30N6O2 — CID 134551077
(E)-N-[(8R)-4-amino-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 134551077) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is (E)-N-[(8R)-4-amino-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[(8R)-4-amino-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 134551077 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (E)-N-[(8R)-4-amino-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)N[C@@H]1CCc2c(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C28H30N6O2/c1-33(2)16-6-9-24(35)32-20-12-15-23-25(26-27(29)30-18-31-28(26)34(23)17-20)19-10-13-22(14-11-19)36-21-7-4-3-5-8-21/h3-11,13-14,18,20H,12,15-17H2,1-2H3,(H,32,35)(H2,29,30,31)/b9-6+/t20-/m1/s1 |
| InChIKey | PZWFSBGEZWBPCO-AQDCRGGLSA-N |
| XLogP | 4.02 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|