C20H28O9 — CID 134552061
(2R,3R,5R)-3-formyloxy-2-(formyloxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2-carboxylic acid (PubChem CID 134552061) has the molecular formula C20H28O9 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2R,3R,5R)-3-formyloxy-2-(formyloxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2-carboxylic acid.
| Compound Name | (2R,3R,5R)-3-formyloxy-2-(formyloxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 134552061 |
| Molecular Formula | C20H28O9 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2R,3R,5R)-3-formyloxy-2-(formyloxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2-carboxylic acid |
| SMILES | CCCCCCCCCC1=CO[C@@]2(C[C@@H](OC=O)[C@](COC=O)(C(=O)O)O2)C1=O |
| InChI | InChI=1S/C20H28O9/c1-2-3-4-5-6-7-8-9-15-11-28-20(17(15)23)10-16(27-14-22)19(29-20,18(24)25)12-26-13-21/h11,13-14,16H,2-10,12H2,1H3,(H,24,25)/t16-,19-,20-/m1/s1 |
| InChIKey | BGCRAPMIKBCSLC-NSISKUIASA-N |
| XLogP | 2.26 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|