C12H16O4 — CID 134552070
(5S)-4-hydroxy-5-[(1S,2E,4E)-1-hydroxyhexa-2,4-dienyl]-3,5-dimethylfuran-2-one (PubChem CID 134552070) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (5S)-4-hydroxy-5-[(1S,2E,4E)-1-hydroxyhexa-2,4-dienyl]-3,5-dimethylfuran-2-one.
| Compound Name | (5S)-4-hydroxy-5-[(1S,2E,4E)-1-hydroxyhexa-2,4-dienyl]-3,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 134552070 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (5S)-4-hydroxy-5-[(1S,2E,4E)-1-hydroxyhexa-2,4-dienyl]-3,5-dimethylfuran-2-one |
| SMILES | C/C=C/C=C/[C@H](O)[C@]1(C)OC(=O)C(C)=C1O |
| InChI | InChI=1S/C12H16O4/c1-4-5-6-7-9(13)12(3)10(14)8(2)11(15)16-12/h4-7,9,13-14H,1-3H3/b5-4+,7-6+/t9-,12-/m0/s1 |
| InChIKey | VEXSXYQPHGSQGW-CNJRYBDGSA-N |
| XLogP | 1.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|