C24H28O5 — CID 134552071
1,3,5-trimethyl-2,8-bis[(3E,5E)-2-oxohepta-3,5-dienyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 134552071) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,8-bis[(3E,5E)-2-oxohepta-3,5-dienyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | 1,3,5-trimethyl-2,8-bis[(3E,5E)-2-oxohepta-3,5-dienyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 134552071 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1,3,5-trimethyl-2,8-bis[(3E,5E)-2-oxohepta-3,5-dienyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | C/C=C/C=C/C(=O)CC1=C(C)C(=O)C2(C)OC(=O)C1(C)C2CC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C24H28O5/c1-6-8-10-12-17(25)14-19-16(3)21(27)24(5)20(23(19,4)22(28)29-24)15-18(26)13-11-9-7-2/h6-13,20H,14-15H2,1-5H3/b8-6+,9-7+,12-10+,13-11+ |
| InChIKey | MQYHPTFEDLOBGS-LZBUJHLNSA-N |
| XLogP | 4.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|