C27H32FN5O6S — CID 134552813
(3R,5R)-1-acetyl-N-[4-[(3Z)-2,4-dimethoxypenta-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-5-(4-fluorophenyl)piperidine-3-sulfonamide (PubChem CID 134552813) has the molecular formula C27H32FN5O6S and a molecular weight of 573.65 g/mol. Its IUPAC name is (3R,5R)-1-acetyl-N-[4-[(3Z)-2,4-dimethoxypenta-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-5-(4-fluorophenyl)piperidine-3-sulfonamide.
| Compound Name | (3R,5R)-1-acetyl-N-[4-[(3Z)-2,4-dimethoxypenta-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-5-(4-fluorophenyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 134552813 |
| Molecular Formula | C27H32FN5O6S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (3R,5R)-1-acetyl-N-[4-[(3Z)-2,4-dimethoxypenta-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-5-(4-fluorophenyl)piperidine-3-sulfonamide |
| SMILES | C=C(OC)/C(=C(\C)OC)n1c(NS(=O)(=O)[C@@H]2C[C@H](c3ccc(F)cc3)CN(C(C)=O)C2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C27H32FN5O6S/c1-16-7-12-24(39-16)26-29-30-27(33(26)25(17(2)37-5)18(3)38-6)31-40(35,36)23-13-21(14-32(15-23)19(4)34)20-8-10-22(28)11-9-20/h7-12,21,23H,2,13-15H2,1,3-6H3,(H,30,31)/b25-18-/t21-,23+/m0/s1 |
| InChIKey | AVXSZUQGMKPVDD-HBFWTWQYSA-N |
| XLogP | 4.13 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|