C12H16FN3O2 — CID 134552937
ethyl (3R)-1-(5-fluoropyrimidin-2-yl)piperidine-3-carboxylate (PubChem CID 134552937) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is ethyl (3R)-1-(5-fluoropyrimidin-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(5-fluoropyrimidin-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 134552937 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | ethyl (3R)-1-(5-fluoropyrimidin-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ncc(F)cn2)C1 |
| InChI | InChI=1S/C12H16FN3O2/c1-2-18-11(17)9-4-3-5-16(8-9)12-14-6-10(13)7-15-12/h6-7,9H,2-5,8H2,1H3/t9-/m1/s1 |
| InChIKey | SEUYBUTVSYUEAU-SECBINFHSA-N |
| XLogP | 1.40 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |