C27H26N6O6S — CID 134552942
(1R,2S)-1-(2,4-dicyanophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide (PubChem CID 134552942) has the molecular formula C27H26N6O6S and a molecular weight of 562.61 g/mol. Its IUPAC name is (1R,2S)-1-(2,4-dicyanophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide.
| Compound Name | (1R,2S)-1-(2,4-dicyanophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 134552942 |
| Molecular Formula | C27H26N6O6S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (1R,2S)-1-(2,4-dicyanophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H](C)[C@H](OC)c2ccc(C#N)cc2C#N)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C27H26N6O6S/c1-16-9-12-23(39-16)26-30-31-27(33(26)24-21(36-3)7-6-8-22(24)37-4)32-40(34,35)17(2)25(38-5)20-11-10-18(14-28)13-19(20)15-29/h6-13,17,25H,1-5H3,(H,31,32)/t17-,25-/m0/s1 |
| InChIKey | VGURITIZYFDDOV-GKVSMKOHSA-N |
| XLogP | 4.11 |
| TPSA | 165.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |