C25H26N6O6S — CID 134553139
(1S,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-imidazo[1,5-a]pyridin-1-ylpropane-2-sulfonamide (PubChem CID 134553139) has the molecular formula C25H26N6O6S and a molecular weight of 538.59 g/mol. Its IUPAC name is (1S,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-imidazo[1,5-a]pyridin-1-ylpropane-2-sulfonamide.
| Compound Name | (1S,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-imidazo[1,5-a]pyridin-1-ylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134553139 |
| Molecular Formula | C25H26N6O6S |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (1S,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-imidazo[1,5-a]pyridin-1-ylpropane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@H](C)[C@@H](O)c2ncn3ccccc23)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C25H26N6O6S/c1-15-11-12-20(37-15)24-27-28-25(31(24)22-18(35-3)9-7-10-19(22)36-4)29-38(33,34)16(2)23(32)21-17-8-5-6-13-30(17)14-26-21/h5-14,16,23,32H,1-4H3,(H,28,29)/t16-,23-/m1/s1 |
| InChIKey | BCGDIWGRAFSAII-WAIKUNEKSA-N |
| XLogP | 3.36 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |