C9H11N3 — CID 134553219
1-[(3E)-2-methylhexa-1,3,5-trien-3-yl]-1,2,4-triazole (PubChem CID 134553219) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1-[(3E)-2-methylhexa-1,3,5-trien-3-yl]-1,2,4-triazole.
| Compound Name | 1-[(3E)-2-methylhexa-1,3,5-trien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 134553219 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-[(3E)-2-methylhexa-1,3,5-trien-3-yl]-1,2,4-triazole |
| SMILES | C=C/C=C(\C(=C)C)n1cncn1 |
| InChI | InChI=1S/C9H11N3/c1-4-5-9(8(2)3)12-7-10-6-11-12/h4-7H,1-2H2,3H3/b9-5+ |
| InChIKey | NFTCQSMRDAZSRA-WEVVVXLNSA-N |
| XLogP | 1.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|