C23H34N6O7S — CID 134553238
(3S,5R)-3-[[4-[(3Z)-2,4-dimethoxyhexa-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 134553238) has the molecular formula C23H34N6O7S and a molecular weight of 538.63 g/mol. Its IUPAC name is (3S,5R)-3-[[4-[(3Z)-2,4-dimethoxyhexa-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | (3S,5R)-3-[[4-[(3Z)-2,4-dimethoxyhexa-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134553238 |
| Molecular Formula | C23H34N6O7S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (3S,5R)-3-[[4-[(3Z)-2,4-dimethoxyhexa-1,3-dien-3-yl]-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | C=C(OC)/C(=C(\CC)OC)n1c(NS(=O)(=O)[C@H]2C[C@@H](O)CN(C(=O)N(C)C)C2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C23H34N6O7S/c1-8-18(35-7)20(15(3)34-6)29-21(19-10-9-14(2)36-19)24-25-22(29)26-37(32,33)17-11-16(30)12-28(13-17)23(31)27(4)5/h9-10,16-17,30H,3,8,11-13H2,1-2,4-7H3,(H,25,26)/b20-18-/t16-,17+/m1/s1 |
| InChIKey | HEPCKQZZHZCTOA-HNQLTLBLSA-N |
| XLogP | 2.09 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|