C21H31ClN4O5S — CID 134553493
N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2-(methylamino)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 134553493) has the molecular formula C21H31ClN4O5S and a molecular weight of 487.02 g/mol. Its IUPAC name is N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2-(methylamino)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2-(methylamino)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134553493 |
| Molecular Formula | C21H31ClN4O5S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[(1S)-1-[4-chloro-3-(cyclopropylmethoxy)phenyl]-2-(methylamino)ethyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | CNC[C@@H](NS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1ccc(Cl)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H31ClN4O5S/c1-23-12-18(16-7-8-17(22)19(11-16)31-14-15-5-6-15)25-32(29,30)10-4-2-3-9-26-13-20(27)24-21(26)28/h7-8,11,15,18,23,25H,2-6,9-10,12-14H2,1H3,(H,24,27,28)/t18-/m1/s1 |
| InChIKey | GWFJABRLDUTDHB-GOSISDBHSA-N |
| XLogP | 2.03 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|