C22H27F3N2O4S — CID 134553531
N-[1-[3-(1,1-difluoroprop-2-enoxy)-4-fluorophenyl]cyclopropyl]-5-(2,6-dioxopiperidin-3-yl)pentane-1-sulfinamide (PubChem CID 134553531) has the molecular formula C22H27F3N2O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is N-[1-[3-(1,1-difluoroprop-2-enoxy)-4-fluorophenyl]cyclopropyl]-5-(2,6-dioxopiperidin-3-yl)pentane-1-sulfinamide.
| Compound Name | N-[1-[3-(1,1-difluoroprop-2-enoxy)-4-fluorophenyl]cyclopropyl]-5-(2,6-dioxopiperidin-3-yl)pentane-1-sulfinamide |
|---|---|
| PubChem CID | 134553531 |
| Molecular Formula | C22H27F3N2O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[1-[3-(1,1-difluoroprop-2-enoxy)-4-fluorophenyl]cyclopropyl]-5-(2,6-dioxopiperidin-3-yl)pentane-1-sulfinamide |
| SMILES | C=CC(F)(F)Oc1cc(C2(NS(=O)CCCCCC3CCC(=O)NC3=O)CC2)ccc1F |
| InChI | InChI=1S/C22H27F3N2O4S/c1-2-22(24,25)31-18-14-16(8-9-17(18)23)21(11-12-21)27-32(30)13-5-3-4-6-15-7-10-19(28)26-20(15)29/h2,8-9,14-15,27H,1,3-7,10-13H2,(H,26,28,29) |
| InChIKey | JSYOZSZUMAAYLF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|