C19H26N2O2 — CID 134553569
3-[(E)-7-[[(1R)-1-phenylethyl]amino]hept-2-enyl]pyrrolidine-2,5-dione (PubChem CID 134553569) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[(E)-7-[[(1R)-1-phenylethyl]amino]hept-2-enyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-7-[[(1R)-1-phenylethyl]amino]hept-2-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134553569 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-[(E)-7-[[(1R)-1-phenylethyl]amino]hept-2-enyl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H](NCCCC/C=C/CC1CC(=O)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-15(16-10-7-5-8-11-16)20-13-9-4-2-3-6-12-17-14-18(22)21-19(17)23/h3,5-8,10-11,15,17,20H,2,4,9,12-14H2,1H3,(H,21,22,23)/b6-3+/t15-,17?/m1/s1 |
| InChIKey | WBLAGNHDBDNKEH-DBBOPBIFSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|