About 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan
4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan (PubChem CID 134553703) has the molecular formula C9H11F3O2
and a molecular weight of 208.18 g/mol. Its IUPAC name is 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan.
Molecular Properties
| Compound Name | 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan |
| PubChem CID | 134553703 |
| Molecular Formula | C9H11F3O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan |
| SMILES | CC(C)c1coc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3O2/c1-6(2)7-3-8(13-4-7)14-5-9(10,11)12/h3-4,6H,5H2,1-2H3 |
| InChIKey | QQAJBPAAVJPFFN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan?
The IUPAC name of 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan (CID 134553703) is 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan.
What is the SMILES notation for 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan?
The canonical SMILES for 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan is CC(C)c1coc(OCC(F)(F)F)c1.
What is the InChIKey of 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan?
The InChIKey is QQAJBPAAVJPFFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O2/c1-6(2)7-3-8(13-4-7)14-5-9(10,11)12/h3-4,6H,5H2,1-2H3.
What are the key properties of 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan?
4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan has a molecular weight of 208.18 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2-(2,2,2-trifluoroethoxy)furan is sourced from PubChem (CID 134553703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).