C23H38N2 — CID 134553744
(Z)-N-(2,2-dimethyl-1-phenylpropyl)-N-(methylideneamino)undec-2-en-3-amine (PubChem CID 134553744) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (Z)-N-(2,2-dimethyl-1-phenylpropyl)-N-(methylideneamino)undec-2-en-3-amine.
| Compound Name | (Z)-N-(2,2-dimethyl-1-phenylpropyl)-N-(methylideneamino)undec-2-en-3-amine |
|---|---|
| PubChem CID | 134553744 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (Z)-N-(2,2-dimethyl-1-phenylpropyl)-N-(methylideneamino)undec-2-en-3-amine |
| SMILES | C=NN(/C(=C\C)CCCCCCCC)C(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H38N2/c1-7-9-10-11-12-16-19-21(8-2)25(24-6)22(23(3,4)5)20-17-14-13-15-18-20/h8,13-15,17-18,22H,6-7,9-12,16,19H2,1-5H3/b21-8- |
| InChIKey | SMWJUSMUXCUYMT-WNFQYIGGSA-N |
| XLogP | 7.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|