C32H37FN4O4 — CID 134553798
tert-butyl 4-[2-[8-[(4-fluorophenyl)methyl]-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]ethyl]piperidine-1-carboxylate (PubChem CID 134553798) has the molecular formula C32H37FN4O4 and a molecular weight of 560.67 g/mol. Its IUPAC name is tert-butyl 4-[2-[8-[(4-fluorophenyl)methyl]-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[8-[(4-fluorophenyl)methyl]-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134553798 |
| Molecular Formula | C32H37FN4O4 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | tert-butyl 4-[2-[8-[(4-fluorophenyl)methyl]-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCN2C(=O)C3Cc4c(n(Cc5ccc(F)cc5)c5ccccc45)CN3C2=O)CC1 |
| InChI | InChI=1S/C32H37FN4O4/c1-32(2,3)41-31(40)34-15-12-21(13-16-34)14-17-35-29(38)27-18-25-24-6-4-5-7-26(24)36(28(25)20-37(27)30(35)39)19-22-8-10-23(33)11-9-22/h4-11,21,27H,12-20H2,1-3H3 |
| InChIKey | ISYRCRUJXIWVIA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|