C23H32FN3O4S2 — CID 134553830
(E)-5-(5,5-dimethyl-2-oxo-4-sulfanylideneimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]pent-3-ene-1-sulfonamide (PubChem CID 134553830) has the molecular formula C23H32FN3O4S2 and a molecular weight of 497.66 g/mol. Its IUPAC name is (E)-5-(5,5-dimethyl-2-oxo-4-sulfanylideneimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]pent-3-ene-1-sulfonamide.
| Compound Name | (E)-5-(5,5-dimethyl-2-oxo-4-sulfanylideneimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 134553830 |
| Molecular Formula | C23H32FN3O4S2 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (E)-5-(5,5-dimethyl-2-oxo-4-sulfanylideneimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]pent-3-ene-1-sulfonamide |
| SMILES | CC(C)COc1cc(C2(NS(=O)(=O)CC/C=C/CN3C(=O)NC(=S)C3(C)C)CC2)ccc1F |
| InChI | InChI=1S/C23H32FN3O4S2/c1-16(2)15-31-19-14-17(8-9-18(19)24)23(10-11-23)26-33(29,30)13-7-5-6-12-27-21(28)25-20(32)22(27,3)4/h5-6,8-9,14,16,26H,7,10-13,15H2,1-4H3,(H,25,28,32)/b6-5+ |
| InChIKey | WYUYQYUKNNYOIM-AATRIKPKSA-N |
| XLogP | 3.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|