C14H23NS2 — CID 134553998
(2R,3R)-3-[3-(disulfanyl)phenyl]-N,N,2-trimethylpentan-1-amine (PubChem CID 134553998) has the molecular formula C14H23NS2 and a molecular weight of 269.48 g/mol. Its IUPAC name is (2R,3R)-3-[3-(disulfanyl)phenyl]-N,N,2-trimethylpentan-1-amine.
| Compound Name | (2R,3R)-3-[3-(disulfanyl)phenyl]-N,N,2-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 134553998 |
| Molecular Formula | C14H23NS2 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2R,3R)-3-[3-(disulfanyl)phenyl]-N,N,2-trimethylpentan-1-amine |
| SMILES | CC[C@@H](c1cccc(SS)c1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C14H23NS2/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(9-12)17-16/h6-9,11,14,16H,5,10H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | HCVCEVPIXLYPGI-SMDDNHRTSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|