About N-ethenyl-N,N'-dimethylpropanimidamide
N-ethenyl-N,N'-dimethylpropanimidamide (PubChem CID 134554083) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N-ethenyl-N,N'-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N,N'-dimethylpropanimidamide |
| PubChem CID | 134554083 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-ethenyl-N,N'-dimethylpropanimidamide |
| SMILES | C=CN(C)/C(CC)=N/C |
| InChI | InChI=1S/C7H14N2/c1-5-7(8-3)9(4)6-2/h6H,2,5H2,1,3-4H3/b8-7+ |
| InChIKey | APWIXSDYPIRSGQ-BQYQJAHWSA-N |
| XLogP | 1.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N,N'-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N,N'-dimethylpropanimidamide?
The IUPAC name of N-ethenyl-N,N'-dimethylpropanimidamide (CID 134554083) is N-ethenyl-N,N'-dimethylpropanimidamide.
What is the SMILES notation for N-ethenyl-N,N'-dimethylpropanimidamide?
The canonical SMILES for N-ethenyl-N,N'-dimethylpropanimidamide is C=CN(C)/C(CC)=N/C.
What is the InChIKey of N-ethenyl-N,N'-dimethylpropanimidamide?
The InChIKey is APWIXSDYPIRSGQ-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H14N2/c1-5-7(8-3)9(4)6-2/h6H,2,5H2,1,3-4H3/b8-7+.
What are the key properties of N-ethenyl-N,N'-dimethylpropanimidamide?
N-ethenyl-N,N'-dimethylpropanimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N,N'-dimethylpropanimidamide is sourced from PubChem (CID 134554083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).