About (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate
(4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 134554656) has the molecular formula C21H25F2N3O2
and a molecular weight of 389.45 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate |
| PubChem CID | 134554656 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(COC(=O)N2CCC(CNc3cccc(C)n3)C(F)(F)C2)cc1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-15-6-8-17(9-7-15)13-28-20(27)26-11-10-18(21(22,23)14-26)12-24-19-5-3-4-16(2)25-19/h3-9,18H,10-14H2,1-2H3,(H,24,25) |
| InChIKey | QMFLBBRNUQOKDR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate?
The IUPAC name of (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate (CID 134554656) is (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate.
What is the SMILES notation for (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate?
The canonical SMILES for (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate is Cc1ccc(COC(=O)N2CCC(CNc3cccc(C)n3)C(F)(F)C2)cc1.
What is the InChIKey of (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate?
The InChIKey is QMFLBBRNUQOKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N3O2/c1-15-6-8-17(9-7-15)13-28-20(27)26-11-10-18(21(22,23)14-26)12-24-19-5-3-4-16(2)25-19/h3-9,18H,10-14H2,1-2H3,(H,24,25).
What are the key properties of (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate?
(4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate has a molecular weight of 389.45 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 3,3-difluoro-4-[[(6-methyl-2-pyridinyl)amino]methyl]piperidine-1-carboxylate is sourced from PubChem (CID 134554656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).