C16H21Cl2N — CID 134554799
(3aS)-7a-(3,4-dichlorophenyl)-2-ethyl-3,3a,4,5,6,7-hexahydro-1H-isoindole (PubChem CID 134554799) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is (3aS)-7a-(3,4-dichlorophenyl)-2-ethyl-3,3a,4,5,6,7-hexahydro-1H-isoindole.
| Compound Name | (3aS)-7a-(3,4-dichlorophenyl)-2-ethyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 134554799 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3aS)-7a-(3,4-dichlorophenyl)-2-ethyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
| SMILES | CCN1C[C@H]2CCCCC2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H21Cl2N/c1-2-19-10-13-5-3-4-8-16(13,11-19)12-6-7-14(17)15(18)9-12/h6-7,9,13H,2-5,8,10-11H2,1H3/t13-,16?/m1/s1 |
| InChIKey | KVTPLEPXMVVCIZ-JBZHPUCOSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |