About CID 13455483
CID 13455483 (PubChem CID 13455483) has the molecular formula C11H11ClF3OSi
and a molecular weight of 279.74 g/mol.
Molecular Properties
| Compound Name | CID 13455483 |
| PubChem CID | 13455483 |
| Molecular Formula | C11H11ClF3OSi |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(C(F)(F)F)cc1O[Si](C)Cl |
| InChI | InChI=1S/C11H11ClF3OSi/c1-3-4-8-5-6-9(11(13,14)15)7-10(8)16-17(2)12/h3,5-7H,1,4H2,2H3 |
| InChIKey | PVPQHWVYHZHLHR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 13455483 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13455483?
The IUPAC name of CID 13455483 (CID 13455483) is not available.
What is the SMILES notation for CID 13455483?
The canonical SMILES for CID 13455483 is C=CCc1ccc(C(F)(F)F)cc1O[Si](C)Cl.
What is the InChIKey of CID 13455483?
The InChIKey is PVPQHWVYHZHLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3OSi/c1-3-4-8-5-6-9(11(13,14)15)7-10(8)16-17(2)12/h3,5-7H,1,4H2,2H3.
What are the key properties of CID 13455483?
CID 13455483 has a molecular weight of 279.74 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13455483 is sourced from PubChem (CID 13455483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).