C9H19N5 — CID 134555198
(3E)-4-(4-methylpiperazin-1-yl)buta-1,3-diene-1,1,4-triamine (PubChem CID 134555198) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is (3E)-4-(4-methylpiperazin-1-yl)buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-4-(4-methylpiperazin-1-yl)buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134555198 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (3E)-4-(4-methylpiperazin-1-yl)buta-1,3-diene-1,1,4-triamine |
| SMILES | CN1CCN(/C(N)=C/C=C(N)N)CC1 |
| InChI | InChI=1S/C9H19N5/c1-13-4-6-14(7-5-13)9(12)3-2-8(10)11/h2-3H,4-7,10-12H2,1H3/b9-3+ |
| InChIKey | NQQGTYRSJKBJRO-YCRREMRBSA-N |
| XLogP | -1.21 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|