About [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone
[(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (PubChem CID 134555294) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
Molecular Properties
| Compound Name | [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| PubChem CID | 134555294 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| SMILES | CC(C)c1ccc2c(n1)CCN(C(=O)[C@H]1CCN1)C2 |
| InChI | InChI=1S/C15H21N3O/c1-10(2)12-4-3-11-9-18(8-6-13(11)17-12)15(19)14-5-7-16-14/h3-4,10,14,16H,5-9H2,1-2H3/t14-/m1/s1 |
| InChIKey | LXPOSTRQGSVJRN-CQSZACIVSA-N |
| XLogP | 1.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone?
The IUPAC name of [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (CID 134555294) is [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
What is the SMILES notation for [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone?
The canonical SMILES for [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone is CC(C)c1ccc2c(n1)CCN(C(=O)[C@H]1CCN1)C2.
What is the InChIKey of [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone?
The InChIKey is LXPOSTRQGSVJRN-CQSZACIVSA-N. The full InChI is InChI=1S/C15H21N3O/c1-10(2)12-4-3-11-9-18(8-6-13(11)17-12)15(19)14-5-7-16-14/h3-4,10,14,16H,5-9H2,1-2H3/t14-/m1/s1.
What are the key properties of [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone?
[(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone has a molecular weight of 259.35 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-azetidin-2-yl]-(2-propan-2-yl-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone is sourced from PubChem (CID 134555294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).