C13H6ClF5N4O — CID 134555469
3-[chloro(difluoro)methyl]-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 134555469) has the molecular formula C13H6ClF5N4O and a molecular weight of 364.66 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[chloro(difluoro)methyl]-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 134555469 |
| Molecular Formula | C13H6ClF5N4O |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc3nnc(C(F)(F)Cl)n3n2)cc1 |
| InChI | InChI=1S/C13H6ClF5N4O/c14-12(15,16)11-21-20-10-6-5-9(22-23(10)11)7-1-3-8(4-2-7)24-13(17,18)19/h1-6H |
| InChIKey | MUAWCAUGVZJHOK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|