C15H10F5N5O — CID 134555661
3-(1,1-difluoroprop-2-enyl)-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-7-amine (PubChem CID 134555661) has the molecular formula C15H10F5N5O and a molecular weight of 371.27 g/mol. Its IUPAC name is 3-(1,1-difluoroprop-2-enyl)-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-7-amine.
| Compound Name | 3-(1,1-difluoroprop-2-enyl)-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-7-amine |
|---|---|
| PubChem CID | 134555661 |
| Molecular Formula | C15H10F5N5O |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-(1,1-difluoroprop-2-enyl)-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-7-amine |
| SMILES | C=CC(F)(F)c1nnc2cc(N)c(-c3ccc(OC(F)(F)F)cc3)nn12 |
| InChI | InChI=1S/C15H10F5N5O/c1-2-14(16,17)13-23-22-11-7-10(21)12(24-25(11)13)8-3-5-9(6-4-8)26-15(18,19)20/h2-7H,1,21H2 |
| InChIKey | YCRDKQWYHSFMFG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|