C35H42FN3 — CID 134555732
2-methyl-5-[(E)-1-[4-[3-[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]propyl]phenyl]-2-phenylhex-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 134555732) has the molecular formula C35H42FN3 and a molecular weight of 523.74 g/mol. Its IUPAC name is 2-methyl-5-[(E)-1-[4-[3-[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]propyl]phenyl]-2-phenylhex-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-methyl-5-[(E)-1-[4-[3-[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]propyl]phenyl]-2-phenylhex-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 134555732 |
| Molecular Formula | C35H42FN3 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | 2-methyl-5-[(E)-1-[4-[3-[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]propyl]phenyl]-2-phenylhex-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CCCC)c2ccccc2)c2ccc(CCCNC/C=C/C(=C)NC)cc2)ccc1C |
| InChI | InChI=1S/C35H42FN3/c1-5-6-16-32(29-14-8-7-9-15-29)34(31-20-17-26(2)33(25-31)35(36)37)30-21-18-28(19-22-30)13-11-24-39-23-10-12-27(3)38-4/h7-10,12,14-15,17-22,25,37-39H,3,5-6,11,13,16,23-24H2,1-2,4H3/b12-10+,34-32+,37-35- |
| InChIKey | PIQLGJYLJNYSNW-UNSKNDAQSA-N |
| XLogP | 8.25 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|