C27H28F4N4 — CID 134555742
2-amino-5-[(Z)-1-[6-(butylaminomethyl)-3-pyridinyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 134555742) has the molecular formula C27H28F4N4 and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-amino-5-[(Z)-1-[6-(butylaminomethyl)-3-pyridinyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-amino-5-[(Z)-1-[6-(butylaminomethyl)-3-pyridinyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 134555742 |
| Molecular Formula | C27H28F4N4 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-amino-5-[(Z)-1-[6-(butylaminomethyl)-3-pyridinyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC(F)(F)F)c2ccccc2)c2ccc(CNCCCC)nc2)ccc1N |
| InChI | InChI=1S/C27H28F4N4/c1-2-3-13-34-17-21-11-9-20(16-35-21)25(19-10-12-24(32)22(14-19)26(28)33)23(15-27(29,30)31)18-7-5-4-6-8-18/h4-12,14,16,33-34H,2-3,13,15,17,32H2,1H3/b25-23-,33-26- |
| InChIKey | QALIRYVOWGFLFZ-BITGLEFPSA-N |
| XLogP | 6.76 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|