C33H36FN3 — CID 134555749
5-[(E)-2-cyclopropyl-1-[4-[[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]methyl]phenyl]-2-phenylethenyl]-N,2-dimethylbenzenecarboximidoyl fluoride (PubChem CID 134555749) has the molecular formula C33H36FN3 and a molecular weight of 493.67 g/mol. Its IUPAC name is 5-[(E)-2-cyclopropyl-1-[4-[[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]methyl]phenyl]-2-phenylethenyl]-N,2-dimethylbenzenecarboximidoyl fluoride.
| Compound Name | 5-[(E)-2-cyclopropyl-1-[4-[[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]methyl]phenyl]-2-phenylethenyl]-N,2-dimethylbenzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 134555749 |
| Molecular Formula | C33H36FN3 |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 5-[(E)-2-cyclopropyl-1-[4-[[[(2E)-4-(methylamino)penta-2,4-dienyl]amino]methyl]phenyl]-2-phenylethenyl]-N,2-dimethylbenzenecarboximidoyl fluoride |
| SMILES | C=C(/C=C/CNCc1ccc(/C(=C(\c2ccccc2)C2CC2)c2ccc(C)c(/C(F)=N/C)c2)cc1)NC |
| InChI | InChI=1S/C33H36FN3/c1-23-12-15-29(21-30(23)33(34)36-4)32(31(28-18-19-28)26-10-6-5-7-11-26)27-16-13-25(14-17-27)22-37-20-8-9-24(2)35-3/h5-17,21,28,35,37H,2,18-20,22H2,1,3-4H3/b9-8+,32-31-,36-33- |
| InChIKey | LXVMHSXRGCAQJR-OBIUNZHQSA-N |
| XLogP | 7.09 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|