C35H43FN4 — CID 134555764
5-[(Z)-2-cyclobutyl-1-[2-[[[(E)-7-(ethenylamino)hept-2-enyl]amino]methyl]-3,4-dihydropyridin-5-yl]-2-phenylethenyl]-2-methylbenzenecarboximidoyl fluoride (PubChem CID 134555764) has the molecular formula C35H43FN4 and a molecular weight of 538.76 g/mol. Its IUPAC name is 5-[(Z)-2-cyclobutyl-1-[2-[[[(E)-7-(ethenylamino)hept-2-enyl]amino]methyl]-3,4-dihydropyridin-5-yl]-2-phenylethenyl]-2-methylbenzenecarboximidoyl fluoride.
| Compound Name | 5-[(Z)-2-cyclobutyl-1-[2-[[[(E)-7-(ethenylamino)hept-2-enyl]amino]methyl]-3,4-dihydropyridin-5-yl]-2-phenylethenyl]-2-methylbenzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 134555764 |
| Molecular Formula | C35H43FN4 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 5-[(Z)-2-cyclobutyl-1-[2-[[[(E)-7-(ethenylamino)hept-2-enyl]amino]methyl]-3,4-dihydropyridin-5-yl]-2-phenylethenyl]-2-methylbenzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(C2=CN=C(CNC/C=C/CCCCNC=C)CC2)=C(/c2ccccc2)C2CCC2)ccc1C |
| InChI | InChI=1S/C35H43FN4/c1-3-38-21-10-5-4-6-11-22-39-25-31-20-19-30(24-40-31)34(29-18-17-26(2)32(23-29)35(36)37)33(28-15-12-16-28)27-13-8-7-9-14-27/h3,6-9,11,13-14,17-18,23-24,28,37-39H,1,4-5,10,12,15-16,19-22,25H2,2H3/b11-6+,34-33+,37-35- |
| InChIKey | CIHRSIHUOAGUTL-ZPIHLSDHSA-N |
| XLogP | 8.17 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|