C10H14N2O — CID 134555979
1-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea (PubChem CID 134555979) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea.
| Compound Name | 1-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea |
|---|---|
| PubChem CID | 134555979 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea |
| SMILES | C=C/C=C\C(=C/C=C)NC(=O)NC |
| InChI | InChI=1S/C10H14N2O/c1-4-6-8-9(7-5-2)12-10(13)11-3/h4-8H,1-2H2,3H3,(H2,11,12,13)/b8-6-,9-7+ |
| InChIKey | XNMYOSJXYJGQFJ-MKKAVFGOSA-N |
| XLogP | 1.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|