About 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine
4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine (PubChem CID 134556103) has the molecular formula C20H39NO
and a molecular weight of 309.54 g/mol. Its IUPAC name is 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine |
| PubChem CID | 134556103 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine |
| SMILES | CC(C)C1([C@@H](C)CC[C@@H](C)C2(C)CCNCC2)CCOCC1 |
| InChI | InChI=1S/C20H39NO/c1-16(2)20(10-14-22-15-11-20)18(4)7-6-17(3)19(5)8-12-21-13-9-19/h16-18,21H,6-15H2,1-5H3/t17-,18+/m1/s1 |
| InChIKey | XAUOIMKAEWCEOF-MSOLQXFVSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine?
The IUPAC name of 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine (CID 134556103) is 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine.
What is the SMILES notation for 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine?
The canonical SMILES for 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine is CC(C)C1([C@@H](C)CC[C@@H](C)C2(C)CCNCC2)CCOCC1.
What is the InChIKey of 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine?
The InChIKey is XAUOIMKAEWCEOF-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H39NO/c1-16(2)20(10-14-22-15-11-20)18(4)7-6-17(3)19(5)8-12-21-13-9-19/h16-18,21H,6-15H2,1-5H3/t17-,18+/m1/s1.
What are the key properties of 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine?
4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine has a molecular weight of 309.54 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-[(2R,5S)-5-(4-propan-2-yloxan-4-yl)hexan-2-yl]piperidine is sourced from PubChem (CID 134556103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).