C16H26N2O3 — CID 134556180
N-(2,2-dimethylpropyl)-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanamide (PubChem CID 134556180) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanamide.
| Compound Name | N-(2,2-dimethylpropyl)-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 134556180 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpentanamide |
| SMILES | CC(CC(C)(C)C(=O)NCC(C)(C)C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H26N2O3/c1-11(18-12(19)7-8-13(18)20)9-16(5,6)14(21)17-10-15(2,3)4/h7-8,11H,9-10H2,1-6H3,(H,17,21) |
| InChIKey | QUEAAUFJZJIDKP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|