About 1-ethyl-2-methylidene-1,3-diazinan-4-one
1-ethyl-2-methylidene-1,3-diazinan-4-one (PubChem CID 134556251) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-ethyl-2-methylidene-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 1-ethyl-2-methylidene-1,3-diazinan-4-one |
| PubChem CID | 134556251 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1-ethyl-2-methylidene-1,3-diazinan-4-one |
| SMILES | C=C1NC(=O)CCN1CC |
| InChI | InChI=1S/C7H12N2O/c1-3-9-5-4-7(10)8-6(9)2/h2-5H2,1H3,(H,8,10) |
| InChIKey | HVLSYRRKTCNIKB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-2-methylidene-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylidene-1,3-diazinan-4-one?
The IUPAC name of 1-ethyl-2-methylidene-1,3-diazinan-4-one (CID 134556251) is 1-ethyl-2-methylidene-1,3-diazinan-4-one.
What is the SMILES notation for 1-ethyl-2-methylidene-1,3-diazinan-4-one?
The canonical SMILES for 1-ethyl-2-methylidene-1,3-diazinan-4-one is C=C1NC(=O)CCN1CC.
What is the InChIKey of 1-ethyl-2-methylidene-1,3-diazinan-4-one?
The InChIKey is HVLSYRRKTCNIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-9-5-4-7(10)8-6(9)2/h2-5H2,1H3,(H,8,10).
What are the key properties of 1-ethyl-2-methylidene-1,3-diazinan-4-one?
1-ethyl-2-methylidene-1,3-diazinan-4-one has a molecular weight of 140.19 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylidene-1,3-diazinan-4-one is sourced from PubChem (CID 134556251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).