C11H16F2N2 — CID 134556292
4-(4,4-difluoro-5-methylhex-5-enyl)-1-methylpyrazole (PubChem CID 134556292) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-(4,4-difluoro-5-methylhex-5-enyl)-1-methylpyrazole.
| Compound Name | 4-(4,4-difluoro-5-methylhex-5-enyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 134556292 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-(4,4-difluoro-5-methylhex-5-enyl)-1-methylpyrazole |
| SMILES | C=C(C)C(F)(F)CCCc1cnn(C)c1 |
| InChI | InChI=1S/C11H16F2N2/c1-9(2)11(12,13)6-4-5-10-7-14-15(3)8-10/h7-8H,1,4-6H2,2-3H3 |
| InChIKey | IXZFDSVULRCUPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|