About 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol
3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol (PubChem CID 134556363) has the molecular formula C12H18OS
and a molecular weight of 210.34 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol |
| PubChem CID | 134556363 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol |
| SMILES | CC1=CC(C)C(S)C=C1OCC1CC1 |
| InChI | InChI=1S/C12H18OS/c1-8-5-9(2)12(14)6-11(8)13-7-10-3-4-10/h5-6,9-10,12,14H,3-4,7H2,1-2H3 |
| InChIKey | SEFQWIHZDHHNJZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol?
The IUPAC name of 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol (CID 134556363) is 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol is CC1=CC(C)C(S)C=C1OCC1CC1.
What is the InChIKey of 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol?
The InChIKey is SEFQWIHZDHHNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OS/c1-8-5-9(2)12(14)6-11(8)13-7-10-3-4-10/h5-6,9-10,12,14H,3-4,7H2,1-2H3.
What are the key properties of 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol?
3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol has a molecular weight of 210.34 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethoxy)-4,6-dimethylcyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 134556363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).