C24H31N3O — CID 134556987
[2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate (PubChem CID 134556987) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is [2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 134556987 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | [2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1cccc2c1CCCC2)OCc1c(C)cccc1NC |
| InChI | InChI=1S/C24H31N3O/c1-5-24(28-16-22-17(2)10-8-15-23(22)25-4)27-26-18(3)20-14-9-12-19-11-6-7-13-21(19)20/h8-10,12,14-15,25H,5-7,11,13,16H2,1-4H3 |
| InChIKey | HDQLJRAKFRZGKP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|