C23H32N4O — CID 134557055
[2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(2,3,6,7-tetrahydro-1H-inden-4-yl)ethylidene]propanehydrazonate (PubChem CID 134557055) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(2,3,6,7-tetrahydro-1H-inden-4-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(2,3,6,7-tetrahydro-1H-inden-4-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 134557055 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(2,3,6,7-tetrahydro-1H-inden-4-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)C1=CCCC2=C1CCC2)OCc1c(C)cccc1N(C)N |
| InChI | InChI=1S/C23H32N4O/c1-5-23(28-15-21-16(2)9-6-14-22(21)27(4)24)26-25-17(3)19-12-7-10-18-11-8-13-20(18)19/h6,9,12,14H,5,7-8,10-11,13,15,24H2,1-4H3 |
| InChIKey | ZTPLJWVSSXPAGM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|