C24H32N4O — CID 134557274
[2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate (PubChem CID 134557274) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 134557274 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1ccc2c(c1)CCCC2)OCc1c(C)cccc1N(C)N |
| InChI | InChI=1S/C24H32N4O/c1-5-24(29-16-22-17(2)9-8-12-23(22)28(4)25)27-26-18(3)20-14-13-19-10-6-7-11-21(19)15-20/h8-9,12-15H,5-7,10-11,16,25H2,1-4H3 |
| InChIKey | BJBUBJDUUKPRGN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|