C11H18N2 — CID 134557940
(2E,4Z)-N-ethyl-5-methyl-2-(methylideneamino)hepta-2,4,6-trien-1-amine (PubChem CID 134557940) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (2E,4Z)-N-ethyl-5-methyl-2-(methylideneamino)hepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-N-ethyl-5-methyl-2-(methylideneamino)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 134557940 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (2E,4Z)-N-ethyl-5-methyl-2-(methylideneamino)hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C(C)=C\C=C(/CNCC)N=C |
| InChI | InChI=1S/C11H18N2/c1-5-10(3)7-8-11(12-4)9-13-6-2/h5,7-8,13H,1,4,6,9H2,2-3H3/b10-7-,11-8+ |
| InChIKey | YYWWXVZOXGDIOC-BDLVGCLISA-N |
| XLogP | 2.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|